C13H15NP2 — CID 101016472
[(1S,2S)-1-phenyl-2-phosphanyl-2-pyridin-2-ylethyl]phosphane (PubChem CID 101016472) has the molecular formula C13H15NP2 and a molecular weight of 247.22 g/mol. Its IUPAC name is [(1S,2S)-1-phenyl-2-phosphanyl-2-pyridin-2-ylethyl]phosphane.
| Compound Name | [(1S,2S)-1-phenyl-2-phosphanyl-2-pyridin-2-ylethyl]phosphane |
|---|---|
| PubChem CID | 101016472 |
| Molecular Formula | C13H15NP2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | [(1S,2S)-1-phenyl-2-phosphanyl-2-pyridin-2-ylethyl]phosphane |
| SMILES | P[C@@H](c1ccccc1)[C@@H](P)c1ccccn1 |
| InChI | InChI=1S/C13H15NP2/c15-12(10-6-2-1-3-7-10)13(16)11-8-4-5-9-14-11/h1-9,12-13H,15-16H2/t12-,13-/m0/s1 |
| InChIKey | IAFNIAMACZNXDP-STQMWFEESA-N |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|