C15H24NO2P — CID 101016686
cis-(1S,2S)-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N,2-trimethylcyclopropan-1-amine (PubChem CID 101016686) has the molecular formula C15H24NO2P and a molecular weight of 281.34 g/mol. Its IUPAC name is cis-(1S,2S)-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N,2-trimethylcyclopropan-1-amine.
| Compound Name | cis-(1S,2S)-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N,2-trimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 101016686 |
| Molecular Formula | C15H24NO2P |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | cis-(1S,2S)-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N,2-trimethylcyclopropan-1-amine |
| SMILES | COP(=O)(CC[C@@]1(N(C)C)C[C@@H]1C)c1ccccc1 |
| InChI | InChI=1S/C15H24NO2P/c1-13-12-15(13,16(2)3)10-11-19(17,18-4)14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3/t13-,15+,19?/m0/s1 |
| InChIKey | DTVDNCHNCWVWCB-AVJPJTGSSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|