C16H26NO2P — CID 101016688
cis-(1S,2R)-2-ethyl-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N-dimethylcyclopropan-1-amine (PubChem CID 101016688) has the molecular formula C16H26NO2P and a molecular weight of 295.36 g/mol. Its IUPAC name is cis-(1S,2R)-2-ethyl-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N-dimethylcyclopropan-1-amine.
| Compound Name | cis-(1S,2R)-2-ethyl-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 101016688 |
| Molecular Formula | C16H26NO2P |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | cis-(1S,2R)-2-ethyl-1-[2-[methoxy(phenyl)phosphoryl]ethyl]-N,N-dimethylcyclopropan-1-amine |
| SMILES | CC[C@@H]1C[C@@]1(CCP(=O)(OC)c1ccccc1)N(C)C |
| InChI | InChI=1S/C16H26NO2P/c1-5-14-13-16(14,17(2)3)11-12-20(18,19-4)15-9-7-6-8-10-15/h6-10,14H,5,11-13H2,1-4H3/t14-,16-,20?/m1/s1 |
| InChIKey | XIXDSNNZRHXWCO-BISUUYRGSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|