C20H26NOP — CID 101016696
trans-(1S,2R)-1-(2-diphenylphosphorylethyl)-N,N,2-trimethylcyclopropan-1-amine (PubChem CID 101016696) has the molecular formula C20H26NOP and a molecular weight of 327.41 g/mol. Its IUPAC name is trans-(1S,2R)-1-(2-diphenylphosphorylethyl)-N,N,2-trimethylcyclopropan-1-amine.
| Compound Name | trans-(1S,2R)-1-(2-diphenylphosphorylethyl)-N,N,2-trimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 101016696 |
| Molecular Formula | C20H26NOP |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | trans-(1S,2R)-1-(2-diphenylphosphorylethyl)-N,N,2-trimethylcyclopropan-1-amine |
| SMILES | C[C@@H]1C[C@@]1(CCP(=O)(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C20H26NOP/c1-17-16-20(17,21(2)3)14-15-23(22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17H,14-16H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | QHTYVQHMYVELNU-YLJYHZDGSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|