C44H58N6O6 — CID 10101689
(1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-prop-2-enyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone (PubChem CID 10101689) has the molecular formula C44H58N6O6 and a molecular weight of 766.98 g/mol. Its IUPAC name is (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-prop-2-enyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone.
| Compound Name | (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-prop-2-enyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
|---|---|
| PubChem CID | 10101689 |
| Molecular Formula | C44H58N6O6 |
| Molecular Weight | 766.98 g/mol |
| Exact Mass | 766.44 |
| IUPAC Name | (1R,8S,11R,17S,20R,23S)-11,20-dibenzyl-23-[(2S)-butan-2-yl]-10-prop-2-enyl-3,10,13,19,22,25-hexazatetracyclo[23.4.0.03,8.013,17]nonacosane-2,9,12,18,21,24-hexone |
| SMILES | C=CCN1C(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C44H58N6O6/c1-4-24-47-37(29-32-19-10-7-11-20-32)43(55)48-27-16-23-34(48)40(52)45-33(28-31-17-8-6-9-18-31)39(51)46-38(30(3)5-2)44(56)50-26-15-13-22-36(50)42(54)49-25-14-12-21-35(49)41(47)53/h4,6-11,17-20,30,33-38H,1,5,12-16,21-29H2,2-3H3,(H,45,52)(H,46,51)/t30-,33+,34-,35-,36+,37+,38-/m0/s1 |
| InChIKey | ZXIHEYCCEPAGMG-BWIPDQASSA-N |
| XLogP | 3.64 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|