C12H14O6 — CID 101016982
dimethyl (5R,6S)-7-oxo-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyran-5,6-dicarboxylate (PubChem CID 101016982) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is dimethyl (5R,6S)-7-oxo-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyran-5,6-dicarboxylate.
| Compound Name | dimethyl (5R,6S)-7-oxo-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 101016982 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | dimethyl (5R,6S)-7-oxo-3,4,5,6-tetrahydro-2H-cyclopenta[b]pyran-5,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(CCCO2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H14O6/c1-16-11(14)7-6-4-3-5-18-10(6)9(13)8(7)12(15)17-2/h7-8H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | NLNOJZKOPUEHLL-YUMQZZPRSA-N |
| XLogP | 0.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|