C18H21O3P — CID 101017151
(2S,3S,4R)-2-(diphenylphosphanylmethyl)oxane-3,4-diol (PubChem CID 101017151) has the molecular formula C18H21O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is (2S,3S,4R)-2-(diphenylphosphanylmethyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4R)-2-(diphenylphosphanylmethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 101017151 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (2S,3S,4R)-2-(diphenylphosphanylmethyl)oxane-3,4-diol |
| SMILES | O[C@H]1[C@H](O)CCO[C@@H]1CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21O3P/c19-16-11-12-21-17(18(16)20)13-22(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-20H,11-13H2/t16-,17-,18+/m1/s1 |
| InChIKey | GZLCZONYOIAFTD-KURKYZTESA-N |
| XLogP | 1.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|