C5H9BrO4 — CID 101017581
(3R,4R,5S)-5-(bromomethyl)oxolane-2,3,4-triol (PubChem CID 101017581) has the molecular formula C5H9BrO4 and a molecular weight of 213.03 g/mol. Its IUPAC name is (3R,4R,5S)-5-(bromomethyl)oxolane-2,3,4-triol.
| Compound Name | (3R,4R,5S)-5-(bromomethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 101017581 |
| Molecular Formula | C5H9BrO4 |
| Molecular Weight | 213.03 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | (3R,4R,5S)-5-(bromomethyl)oxolane-2,3,4-triol |
| SMILES | OC1O[C@H](CBr)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C5H9BrO4/c6-1-2-3(7)4(8)5(9)10-2/h2-5,7-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| InChIKey | VICOKPRQEGIZIT-IOVATXLUSA-N |
| XLogP | -1.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.03 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|