About 9-pyridin-2-ylcarbazole
9-pyridin-2-ylcarbazole (PubChem CID 10101763) has the molecular formula C17H12N2
and a molecular weight of 244.30 g/mol. Its IUPAC name is 9-pyridin-2-ylcarbazole.
Molecular Properties
| Compound Name | 9-pyridin-2-ylcarbazole |
| PubChem CID | 10101763 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 9-pyridin-2-ylcarbazole |
| SMILES | c1ccc(-n2c3ccccc3c3ccccc32)nc1 |
| InChI | InChI=1S/C17H12N2/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)19(15)17-11-5-6-12-18-17/h1-12H |
| InChIKey | JDINBEDUGBFLEC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-pyridin-2-ylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pyridin-2-ylcarbazole?
The IUPAC name of 9-pyridin-2-ylcarbazole (CID 10101763) is 9-pyridin-2-ylcarbazole.
What is the SMILES notation for 9-pyridin-2-ylcarbazole?
The canonical SMILES for 9-pyridin-2-ylcarbazole is c1ccc(-n2c3ccccc3c3ccccc32)nc1.
What is the InChIKey of 9-pyridin-2-ylcarbazole?
The InChIKey is JDINBEDUGBFLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2/c1-3-9-15-13(7-1)14-8-2-4-10-16(14)19(15)17-11-5-6-12-18-17/h1-12H.
What are the key properties of 9-pyridin-2-ylcarbazole?
9-pyridin-2-ylcarbazole has a molecular weight of 244.30 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pyridin-2-ylcarbazole is sourced from PubChem (CID 10101763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).