C42H67NO11 — CID 101017653
methyl 2-ethyl-2-[(R)-[ethyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]-phenylmethyl]butanoate (PubChem CID 101017653) has the molecular formula C42H67NO11 and a molecular weight of 761.99 g/mol. Its IUPAC name is methyl 2-ethyl-2-[(R)-[ethyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]-phenylmethyl]butanoate.
| Compound Name | methyl 2-ethyl-2-[(R)-[ethyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]-phenylmethyl]butanoate |
|---|---|
| PubChem CID | 101017653 |
| Molecular Formula | C42H67NO11 |
| Molecular Weight | 761.99 g/mol |
| Exact Mass | 761.47 |
| IUPAC Name | methyl 2-ethyl-2-[(R)-[ethyl-[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]-phenylmethyl]butanoate |
| SMILES | CCN([C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C)[C@H](c1ccccc1)C(CC)(CC)C(=O)OC |
| InChI | InChI=1S/C42H67NO11/c1-17-42(18-2,37(48)49-16)31(26-23-21-20-22-24-26)43(19-3)32-30(54-36(47)41(13,14)15)29(53-35(46)40(10,11)12)28(52-34(45)39(7,8)9)27(51-32)25-50-33(44)38(4,5)6/h20-24,27-32H,17-19,25H2,1-16H3/t27-,28-,29+,30-,31-,32-/m1/s1 |
| InChIKey | XPHJDGIUAMHGDE-RJVJZGPBSA-N |
| XLogP | 7.22 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.99 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|