C19H29NO2 — CID 101018304
(1R,2S,4R,6R,9S,13S,15R)-6,10,10,13-tetramethyl-3,18-dioxa-11-azapentacyclo[13.2.1.01,13.02,11.04,9]octadec-16-ene (PubChem CID 101018304) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (1R,2S,4R,6R,9S,13S,15R)-6,10,10,13-tetramethyl-3,18-dioxa-11-azapentacyclo[13.2.1.01,13.02,11.04,9]octadec-16-ene.
| Compound Name | (1R,2S,4R,6R,9S,13S,15R)-6,10,10,13-tetramethyl-3,18-dioxa-11-azapentacyclo[13.2.1.01,13.02,11.04,9]octadec-16-ene |
|---|---|
| PubChem CID | 101018304 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (1R,2S,4R,6R,9S,13S,15R)-6,10,10,13-tetramethyl-3,18-dioxa-11-azapentacyclo[13.2.1.01,13.02,11.04,9]octadec-16-ene |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]1N(C[C@]3(C)C[C@@H]4C=C[C@]13O4)C2(C)C |
| InChI | InChI=1S/C19H29NO2/c1-12-5-6-14-15(9-12)21-16-19-8-7-13(22-19)10-18(19,4)11-20(16)17(14,2)3/h7-8,12-16H,5-6,9-11H2,1-4H3/t12-,13+,14-,15-,16+,18+,19+/m1/s1 |
| InChIKey | DEMDVLRAQISTDF-WTPKRDNOSA-N |
| XLogP | 3.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|