C19H29NO2 — CID 101018314
(1R,5S,8R,10R,12S,13R,14R,15R)-4,4,8,14-tetramethyl-11,18-dioxa-3-azapentacyclo[13.2.1.01,13.03,12.05,10]octadec-16-ene (PubChem CID 101018314) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (1R,5S,8R,10R,12S,13R,14R,15R)-4,4,8,14-tetramethyl-11,18-dioxa-3-azapentacyclo[13.2.1.01,13.03,12.05,10]octadec-16-ene.
| Compound Name | (1R,5S,8R,10R,12S,13R,14R,15R)-4,4,8,14-tetramethyl-11,18-dioxa-3-azapentacyclo[13.2.1.01,13.03,12.05,10]octadec-16-ene |
|---|---|
| PubChem CID | 101018314 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (1R,5S,8R,10R,12S,13R,14R,15R)-4,4,8,14-tetramethyl-11,18-dioxa-3-azapentacyclo[13.2.1.01,13.03,12.05,10]octadec-16-ene |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@@H]3[C@@H](C)[C@H]4C=C[C@@]3(CN1C2(C)C)O4 |
| InChI | InChI=1S/C19H29NO2/c1-11-5-6-13-15(9-11)21-17-16-12(2)14-7-8-19(16,22-14)10-20(17)18(13,3)4/h7-8,11-17H,5-6,9-10H2,1-4H3/t11-,12+,13-,14-,15-,16+,17+,19+/m1/s1 |
| InChIKey | FIUSXBBEACIPPO-SQHVCIQUSA-N |
| XLogP | 3.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|