C27H22N2O7 — CID 101018692
4-[3,5-bis(4-aminophenoxy)phenoxy]-2-methoxycarbonylbenzoic acid (PubChem CID 101018692) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is 4-[3,5-bis(4-aminophenoxy)phenoxy]-2-methoxycarbonylbenzoic acid.
| Compound Name | 4-[3,5-bis(4-aminophenoxy)phenoxy]-2-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 101018692 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 4-[3,5-bis(4-aminophenoxy)phenoxy]-2-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1cc(Oc2cc(Oc3ccc(N)cc3)cc(Oc3ccc(N)cc3)c2)ccc1C(=O)O |
| InChI | InChI=1S/C27H22N2O7/c1-33-27(32)25-15-20(10-11-24(25)26(30)31)36-23-13-21(34-18-6-2-16(28)3-7-18)12-22(14-23)35-19-8-4-17(29)5-9-19/h2-15H,28-29H2,1H3,(H,30,31) |
| InChIKey | IRCNLYILBRTKBQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|