About 1-isocyanopyrene
1-isocyanopyrene (PubChem CID 101019001) has the molecular formula C17H9N
and a molecular weight of 227.27 g/mol. Its IUPAC name is 1-isocyanopyrene.
Molecular Properties
| Compound Name | 1-isocyanopyrene |
| PubChem CID | 101019001 |
| Molecular Formula | C17H9N |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-isocyanopyrene |
| SMILES | [C-]#[N+]c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C17H9N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10H |
| InChIKey | SFSFQHRDVXWQJK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanopyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanopyrene?
The IUPAC name of 1-isocyanopyrene (CID 101019001) is 1-isocyanopyrene.
What is the SMILES notation for 1-isocyanopyrene?
The canonical SMILES for 1-isocyanopyrene is [C-]#[N+]c1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 1-isocyanopyrene?
The InChIKey is SFSFQHRDVXWQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10H.
What are the key properties of 1-isocyanopyrene?
1-isocyanopyrene has a molecular weight of 227.27 g/mol, XLogP of 5.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanopyrene is sourced from PubChem (CID 101019001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).