C18H35BrO3Si — CID 101019742
(2S,3S)-5-bromo-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-3-en-2-yl]hex-5-ene-1,3-diol (PubChem CID 101019742) has the molecular formula C18H35BrO3Si and a molecular weight of 407.47 g/mol. Its IUPAC name is (2S,3S)-5-bromo-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-3-en-2-yl]hex-5-ene-1,3-diol.
| Compound Name | (2S,3S)-5-bromo-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-3-en-2-yl]hex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 101019742 |
| Molecular Formula | C18H35BrO3Si |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S,3S)-5-bromo-2-[(E)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-3-en-2-yl]hex-5-ene-1,3-diol |
| SMILES | C=C(Br)C[C@H](O)[C@H](CO)C(C)(C)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35BrO3Si/c1-14(19)12-16(21)15(13-20)18(5,6)10-9-11-22-23(7,8)17(2,3)4/h9-10,15-16,20-21H,1,11-13H2,2-8H3/b10-9+/t15-,16-/m0/s1 |
| InChIKey | DTCSUKSFRBBMLN-IGXNXKSNSA-N |
| XLogP | 4.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|