C33H48O6 — CID 101019916
6-[[7'-(6-hydroxyhexoxy)-4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7-yl]oxy]hexan-1-ol (PubChem CID 101019916) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is 6-[[7'-(6-hydroxyhexoxy)-4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7-yl]oxy]hexan-1-ol.
| Compound Name | 6-[[7'-(6-hydroxyhexoxy)-4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7-yl]oxy]hexan-1-ol |
|---|---|
| PubChem CID | 101019916 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 6-[[7'-(6-hydroxyhexoxy)-4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-7-yl]oxy]hexan-1-ol |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(OCCCCCCO)cc3O2)Oc2cc(OCCCCCCO)ccc21 |
| InChI | InChI=1S/C33H48O6/c1-31(2)23-33(38-29-21-25(13-15-27(29)31)36-19-11-7-5-9-17-34)24-32(3,4)28-16-14-26(22-30(28)39-33)37-20-12-8-6-10-18-35/h13-16,21-22,34-35H,5-12,17-20,23-24H2,1-4H3 |
| InChIKey | RRSDDNNVCNMTEJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|