C19H15ClN6O4S2 — CID 101019987
N-(4-chlorophenyl)-4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-3-nitrobenzenesulfonamide (PubChem CID 101019987) has the molecular formula C19H15ClN6O4S2 and a molecular weight of 490.95 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101019987 |
| Molecular Formula | C19H15ClN6O4S2 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc(C)n2nc(Sc3ccc(S(=O)(=O)Nc4ccc(Cl)cc4)cc3[N+](=O)[O-])nc2n1 |
| InChI | InChI=1S/C19H15ClN6O4S2/c1-11-9-12(2)25-18(21-11)22-19(23-25)31-17-8-7-15(10-16(17)26(27)28)32(29,30)24-14-5-3-13(20)4-6-14/h3-10,24H,1-2H3 |
| InChIKey | YQCQSORTTZGKSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|