C18H37NaO7S — CID 101020285
sodium 1-[2-(2-decoxyethoxy)ethoxy]butan-2-yl sulfate (PubChem CID 101020285) has the molecular formula C18H37NaO7S and a molecular weight of 420.54 g/mol. Its IUPAC name is sodium 1-[2-(2-decoxyethoxy)ethoxy]butan-2-yl sulfate.
| Compound Name | sodium 1-[2-(2-decoxyethoxy)ethoxy]butan-2-yl sulfate |
|---|---|
| PubChem CID | 101020285 |
| Molecular Formula | C18H37NaO7S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | sodium 1-[2-(2-decoxyethoxy)ethoxy]butan-2-yl sulfate |
| SMILES | CCCCCCCCCCOCCOCCOCC(CC)OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H38O7S.Na/c1-3-5-6-7-8-9-10-11-12-22-13-14-23-15-16-24-17-18(4-2)25-26(19,20)21;/h18H,3-17H2,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | UZQLOPACUMMVIG-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|