C20H30O9 — CID 101020510
ethyl (3'R,3aR,4R,4'Z,6R,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4'-(2-hydroxyethylidene)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-oxolane]-3'-carboxylate (PubChem CID 101020510) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is ethyl (3'R,3aR,4R,4'Z,6R,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4'-(2-hydroxyethylidene)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-oxolane]-3'-carboxylate.
| Compound Name | ethyl (3'R,3aR,4R,4'Z,6R,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4'-(2-hydroxyethylidene)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 101020510 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethyl (3'R,3aR,4R,4'Z,6R,6aR)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4'-(2-hydroxyethylidene)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-oxolane]-3'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1/C(=C/CO)CO[C@@]12O[C@H]([C@H]1COC(C)(C)O1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H30O9/c1-6-23-17(22)13-11(7-8-21)9-25-20(13)16-15(27-19(4,5)29-16)14(28-20)12-10-24-18(2,3)26-12/h7,12-16,21H,6,8-10H2,1-5H3/b11-7+/t12-,13+,14-,15-,16-,20-/m1/s1 |
| InChIKey | ZSVQDZFHARKHNE-RYLFAFMNSA-N |
| XLogP | 0.88 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|