C20H38O3Si2 — CID 101021156
[(2R,3R)-2,3-dimethyl-3-(4-methylpent-3-enyl)-4-(1-trimethylsilyloxyethenyl)-2H-furan-5-yl]oxy-trimethylsilane (PubChem CID 101021156) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is [(2R,3R)-2,3-dimethyl-3-(4-methylpent-3-enyl)-4-(1-trimethylsilyloxyethenyl)-2H-furan-5-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R)-2,3-dimethyl-3-(4-methylpent-3-enyl)-4-(1-trimethylsilyloxyethenyl)-2H-furan-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101021156 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [(2R,3R)-2,3-dimethyl-3-(4-methylpent-3-enyl)-4-(1-trimethylsilyloxyethenyl)-2H-furan-5-yl]oxy-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)C1=C(O[Si](C)(C)C)O[C@H](C)[C@]1(C)CCC=C(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-15(2)13-12-14-20(5)17(4)21-19(23-25(9,10)11)18(20)16(3)22-24(6,7)8/h13,17H,3,12,14H2,1-2,4-11H3/t17-,20+/m1/s1 |
| InChIKey | XBZOSKDOUUKENX-XLIONFOSSA-N |
| XLogP | 6.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|