C10H16O2 — CID 101021221
1-ethenyl-5-(methoxymethoxy)cyclohexene (PubChem CID 101021221) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-ethenyl-5-(methoxymethoxy)cyclohexene.
| Compound Name | 1-ethenyl-5-(methoxymethoxy)cyclohexene |
|---|---|
| PubChem CID | 101021221 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-ethenyl-5-(methoxymethoxy)cyclohexene |
| SMILES | C=CC1=CCCC(OCOC)C1 |
| InChI | InChI=1S/C10H16O2/c1-3-9-5-4-6-10(7-9)12-8-11-2/h3,5,10H,1,4,6-8H2,2H3 |
| InChIKey | MPGSCMULPSLRHM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|