C20H33ClO — CID 101021524
(1S,4R,9R,10R,13R,14R)-14-(chloromethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol (PubChem CID 101021524) has the molecular formula C20H33ClO and a molecular weight of 324.94 g/mol. Its IUPAC name is (1S,4R,9R,10R,13R,14R)-14-(chloromethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol.
| Compound Name | (1S,4R,9R,10R,13R,14R)-14-(chloromethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol |
|---|---|
| PubChem CID | 101021524 |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.94 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (1S,4R,9R,10R,13R,14R)-14-(chloromethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CC[C@@]13C[C@@H](CC[C@H]12)[C@@](O)(CCl)C3 |
| InChI | InChI=1S/C20H33ClO/c1-17(2)8-4-9-18(3)15(17)7-10-19-11-14(5-6-16(18)19)20(22,12-19)13-21/h14-16,22H,4-13H2,1-3H3/t14-,15-,16+,18-,19+,20+/m1/s1 |
| InChIKey | BOHSULPVIZQJSM-URTLRTLISA-N |
| XLogP | 5.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.94 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|