C9H17IO2 — CID 101021701
(2S,3R,4R,5S)-3-ethoxy-2-(iodomethyl)-4,5-dimethyloxolane (PubChem CID 101021701) has the molecular formula C9H17IO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-ethoxy-2-(iodomethyl)-4,5-dimethyloxolane.
| Compound Name | (2S,3R,4R,5S)-3-ethoxy-2-(iodomethyl)-4,5-dimethyloxolane |
|---|---|
| PubChem CID | 101021701 |
| Molecular Formula | C9H17IO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (2S,3R,4R,5S)-3-ethoxy-2-(iodomethyl)-4,5-dimethyloxolane |
| SMILES | CCO[C@@H]1[C@H](C)[C@H](C)O[C@@H]1CI |
| InChI | InChI=1S/C9H17IO2/c1-4-11-9-6(2)7(3)12-8(9)5-10/h6-9H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | LFLKQIIQVIZJEX-BZNPZCIMSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|