C24H14N2O8S8 — CID 101022850
dimethyl 2-[[(2E)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-5-cyano-1,3-dithiol-2-ylidene]-5-cyano-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101022850) has the molecular formula C24H14N2O8S8 and a molecular weight of 714.92 g/mol. Its IUPAC name is dimethyl 2-[[(2E)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-5-cyano-1,3-dithiol-2-ylidene]-5-cyano-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[[(2E)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-5-cyano-1,3-dithiol-2-ylidene]-5-cyano-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101022850 |
| Molecular Formula | C24H14N2O8S8 |
| Molecular Weight | 714.92 g/mol |
| Exact Mass | 713.85 |
| IUPAC Name | dimethyl 2-[[(2E)-2-[4-[[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]methyl]-5-cyano-1,3-dithiol-2-ylidene]-5-cyano-1,3-dithiol-4-yl]methylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC2=C(C#N)S/C(=C3/SC(C#N)=C(C=C4SC(C(=O)OC)=C(C(=O)OC)S4)S3)S2)S1 |
| InChI | InChI=1S/C24H14N2O8S8/c1-31-19(27)15-16(20(28)32-2)40-13(39-15)5-9-11(7-25)37-23(35-9)24-36-10(12(8-26)38-24)6-14-41-17(21(29)33-3)18(42-14)22(30)34-4/h5-6H,1-4H3/b24-23+ |
| InChIKey | FOUIFLDBELHHFI-WCWDXBQESA-N |
| XLogP | 6.30 |
| TPSA | 152.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|