About CID 101023241
CID 101023241 (PubChem CID 101023241) has the molecular formula C24H23N4O5P
and a molecular weight of 478.45 g/mol.
Molecular Properties
| Compound Name | CID 101023241 |
| PubChem CID | 101023241 |
| Molecular Formula | C24H23N4O5P |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)C1=C(N)[C@@H](C#N)C2(C(=O)Nc3ccccc32)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H23N4O5P/c1-3-32-34(31,33-4-2)20-19(26)16(13-25)23(14-9-5-7-11-17(14)27-21(23)29)24(20)15-10-6-8-12-18(15)28-22(24)30/h5-12,16H,3-4,26H2,1-2H3,(H,27,29)(H,28,30)/t16-,23?,24?/m1/s1 |
| InChIKey | BYTIKKLACCPHNA-INTLSFHXSA-N |
| XLogP | 3.36 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 101023241 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101023241?
The IUPAC name of CID 101023241 (CID 101023241) is not available.
What is the SMILES notation for CID 101023241?
The canonical SMILES for CID 101023241 is CCOP(=O)(OCC)C1=C(N)[C@@H](C#N)C2(C(=O)Nc3ccccc32)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 101023241?
The InChIKey is BYTIKKLACCPHNA-INTLSFHXSA-N. The full InChI is InChI=1S/C24H23N4O5P/c1-3-32-34(31,33-4-2)20-19(26)16(13-25)23(14-9-5-7-11-17(14)27-21(23)29)24(20)15-10-6-8-12-18(15)28-22(24)30/h5-12,16H,3-4,26H2,1-2H3,(H,27,29)(H,28,30)/t16-,23?,24?/m1/s1.
What are the key properties of CID 101023241?
CID 101023241 has a molecular weight of 478.45 g/mol, XLogP of 3.36, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101023241 is sourced from PubChem (CID 101023241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).