C10H10N2O2SSe — CID 101023541
N,N-dimethyl-5-(5-nitrothiophen-2-yl)selenophen-2-amine (PubChem CID 101023541) has the molecular formula C10H10N2O2SSe and a molecular weight of 301.23 g/mol. Its IUPAC name is N,N-dimethyl-5-(5-nitrothiophen-2-yl)selenophen-2-amine.
| Compound Name | N,N-dimethyl-5-(5-nitrothiophen-2-yl)selenophen-2-amine |
|---|---|
| PubChem CID | 101023541 |
| Molecular Formula | C10H10N2O2SSe |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | N,N-dimethyl-5-(5-nitrothiophen-2-yl)selenophen-2-amine |
| SMILES | CN(C)c1ccc(-c2ccc([N+](=O)[O-])s2)[se]1 |
| InChI | InChI=1S/C10H10N2O2SSe/c1-11(2)10-6-4-8(16-10)7-3-5-9(15-7)12(13)14/h3-6H,1-2H3 |
| InChIKey | VQCULONAXRNJSD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|