C29H35NO11 — CID 101023805
(7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(1,1-dimethoxyethyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 101023805) has the molecular formula C29H35NO11 and a molecular weight of 573.60 g/mol. Its IUPAC name is (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(1,1-dimethoxyethyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(1,1-dimethoxyethyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 101023805 |
| Molecular Formula | C29H35NO11 |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-(1,1-dimethoxyethyl)-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)(OC)OC)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C29H35NO11/c1-12-23(31)15(30)9-18(40-12)41-17-11-29(36,28(2,38-4)39-5)10-14-20(17)27(35)22-21(25(14)33)24(32)13-7-6-8-16(37-3)19(13)26(22)34/h6-8,12,15,17-18,23,31,33,35-36H,9-11,30H2,1-5H3/t12-,15-,17-,18-,23+,29-/m0/s1 |
| InChIKey | VMMKRBIRJQLCEU-ZSUATTPTSA-N |
| XLogP | 1.45 |
| TPSA | 187.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|