C20H21NO4 — CID 101023818
(6aS,12aS)-2-methoxy-7,7-dimethyl-5,6a,12,12a-tetrahydroisochromeno[4,3-b]quinoline-9-carboxylic acid (PubChem CID 101023818) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (6aS,12aS)-2-methoxy-7,7-dimethyl-5,6a,12,12a-tetrahydroisochromeno[4,3-b]quinoline-9-carboxylic acid.
| Compound Name | (6aS,12aS)-2-methoxy-7,7-dimethyl-5,6a,12,12a-tetrahydroisochromeno[4,3-b]quinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 101023818 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (6aS,12aS)-2-methoxy-7,7-dimethyl-5,6a,12,12a-tetrahydroisochromeno[4,3-b]quinoline-9-carboxylic acid |
| SMILES | COc1ccc2c(c1)[C@@H]1Nc3ccc(C(=O)O)cc3C(C)(C)[C@@H]1OC2 |
| InChI | InChI=1S/C20H21NO4/c1-20(2)15-8-11(19(22)23)5-7-16(15)21-17-14-9-13(24-3)6-4-12(14)10-25-18(17)20/h4-9,17-18,21H,10H2,1-3H3,(H,22,23)/t17-,18+/m0/s1 |
| InChIKey | XPSDCZSCVZUSGF-ZWKOTPCHSA-N |
| XLogP | 3.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |