C18H28O4 — CID 101024678
ethyl (7'aS)-5,5,7'a-trimethylspiro[1,3-dioxane-2,1'-3,5,6,7-tetrahydro-2H-indene]-4'-carboxylate (PubChem CID 101024678) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethyl (7'aS)-5,5,7'a-trimethylspiro[1,3-dioxane-2,1'-3,5,6,7-tetrahydro-2H-indene]-4'-carboxylate.
| Compound Name | ethyl (7'aS)-5,5,7'a-trimethylspiro[1,3-dioxane-2,1'-3,5,6,7-tetrahydro-2H-indene]-4'-carboxylate |
|---|---|
| PubChem CID | 101024678 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethyl (7'aS)-5,5,7'a-trimethylspiro[1,3-dioxane-2,1'-3,5,6,7-tetrahydro-2H-indene]-4'-carboxylate |
| SMILES | CCOC(=O)C1=C2CCC3(OCC(C)(C)CO3)[C@@]2(C)CCC1 |
| InChI | InChI=1S/C18H28O4/c1-5-20-15(19)13-7-6-9-17(4)14(13)8-10-18(17)21-11-16(2,3)12-22-18/h5-12H2,1-4H3/t17-/m0/s1 |
| InChIKey | CPGVAOXNAPERPX-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |