C9H13NO3 — CID 101024789
(2R,3S,5R)-2-(hydroxymethyl)-5-pyrrol-1-yloxolan-3-ol (PubChem CID 101024789) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-pyrrol-1-yloxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-pyrrol-1-yloxolan-3-ol |
|---|---|
| PubChem CID | 101024789 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-pyrrol-1-yloxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2cccc2)C[C@@H]1O |
| InChI | InChI=1S/C9H13NO3/c11-6-8-7(12)5-9(13-8)10-3-1-2-4-10/h1-4,7-9,11-12H,5-6H2/t7-,8+,9+/m0/s1 |
| InChIKey | OTPKQRNRZNIRJQ-DJLDLDEBSA-N |
| XLogP | 0.13 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |