About tri(propan-2-yl)germyl 2-methylprop-2-enoate
tri(propan-2-yl)germyl 2-methylprop-2-enoate (PubChem CID 101025026) has the molecular formula C13H26GeO2
and a molecular weight of 286.96 g/mol. Its IUPAC name is tri(propan-2-yl)germyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | tri(propan-2-yl)germyl 2-methylprop-2-enoate |
| PubChem CID | 101025026 |
| Molecular Formula | C13H26GeO2 |
| Molecular Weight | 286.96 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | tri(propan-2-yl)germyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Ge](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H26GeO2/c1-9(2)13(15)16-14(10(3)4,11(5)6)12(7)8/h10-12H,1H2,2-8H3 |
| InChIKey | BKFXDMMYOBQBOL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)germyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)germyl 2-methylprop-2-enoate?
The IUPAC name of tri(propan-2-yl)germyl 2-methylprop-2-enoate (CID 101025026) is tri(propan-2-yl)germyl 2-methylprop-2-enoate.
What is the SMILES notation for tri(propan-2-yl)germyl 2-methylprop-2-enoate?
The canonical SMILES for tri(propan-2-yl)germyl 2-methylprop-2-enoate is C=C(C)C(=O)O[Ge](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)germyl 2-methylprop-2-enoate?
The InChIKey is BKFXDMMYOBQBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26GeO2/c1-9(2)13(15)16-14(10(3)4,11(5)6)12(7)8/h10-12H,1H2,2-8H3.
What are the key properties of tri(propan-2-yl)germyl 2-methylprop-2-enoate?
tri(propan-2-yl)germyl 2-methylprop-2-enoate has a molecular weight of 286.96 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)germyl 2-methylprop-2-enoate is sourced from PubChem (CID 101025026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).