About methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate
methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 1010251) has the molecular formula C15H11Cl2NO3S
and a molecular weight of 356.23 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate |
| PubChem CID | 1010251 |
| Molecular Formula | C15H11Cl2NO3S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO3S/c1-21-15(20)14-12(6-7-22-14)18-13(19)5-3-9-2-4-10(16)8-11(9)17/h2-8H,1H3,(H,18,19)/b5-3+ |
| InChIKey | CZQWRFCCMCNYGC-HWKANZROSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate (CID 1010251) is methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)/C=C/c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate?
The InChIKey is CZQWRFCCMCNYGC-HWKANZROSA-N. The full InChI is InChI=1S/C15H11Cl2NO3S/c1-21-15(20)14-12(6-7-22-14)18-13(19)5-3-9-2-4-10(16)8-11(9)17/h2-8H,1H3,(H,18,19)/b5-3+.
What are the key properties of methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate?
methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate has a molecular weight of 356.23 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 1010251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).