C11H14N2O8 — CID 101026196
5-nitro-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyridin-2-one (PubChem CID 101026196) has the molecular formula C11H14N2O8 and a molecular weight of 302.24 g/mol. Its IUPAC name is 5-nitro-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyridin-2-one.
| Compound Name | 5-nitro-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 101026196 |
| Molecular Formula | C11H14N2O8 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-nitro-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyridin-2-one |
| SMILES | O=c1ccc([N+](=O)[O-])cn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14N2O8/c14-4-6-8(16)9(17)10(18)11(21-6)12-3-5(13(19)20)1-2-7(12)15/h1-3,6,8-11,14,16-18H,4H2/t6-,8-,9+,10-,11-/m1/s1 |
| InChIKey | SDTSFGWXLZOCCH-WVTGURRWSA-N |
| XLogP | -2.27 |
| TPSA | 155.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|