C16H17NO5 — CID 101026254
(3aR,6R,6aS)-2,2-dimethyl-5-(5-phenyl-1,2-oxazol-3-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 101026254) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (3aR,6R,6aS)-2,2-dimethyl-5-(5-phenyl-1,2-oxazol-3-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,6R,6aS)-2,2-dimethyl-5-(5-phenyl-1,2-oxazol-3-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 101026254 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (3aR,6R,6aS)-2,2-dimethyl-5-(5-phenyl-1,2-oxazol-3-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2OC(c3cc(-c4ccccc4)on3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C16H17NO5/c1-16(2)20-14-12(18)13(19-15(14)21-16)10-8-11(22-17-10)9-6-4-3-5-7-9/h3-8,12-15,18H,1-2H3/t12-,13?,14+,15-/m1/s1 |
| InChIKey | ABGAZWFBIVFSIJ-FSJTYKKLSA-N |
| XLogP | 2.25 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |