C15H20O7 — CID 101026417
methyl (1R,2S,6S,7S)-1,11,11-trimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate (PubChem CID 101026417) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl (1R,2S,6S,7S)-1,11,11-trimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,2S,6S,7S)-1,11,11-trimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 101026417 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl (1R,2S,6S,7S)-1,11,11-trimethoxy-10-oxo-3-oxatricyclo[5.2.2.02,6]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=C[C@]2(OC)C(=O)C(OC)(OC)[C@H]1[C@@H]1CCO[C@@H]12 |
| InChI | InChI=1S/C15H20O7/c1-18-12(16)9-7-14(19-2)11-8(5-6-22-11)10(9)15(20-3,21-4)13(14)17/h7-8,10-11H,5-6H2,1-4H3/t8-,10-,11-,14+/m0/s1 |
| InChIKey | CRTARFLNCUKVRE-GEEFMHANSA-N |
| XLogP | 0.08 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|