About methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate
methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate (PubChem CID 101026694) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate |
| PubChem CID | 101026694 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate |
| SMILES | COC(=O)CC[C@@H]1CCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-17-15(16)11-10-13-8-5-9-14(13)12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | DBCYFXXJJFAATO-KBPBESRZSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate?
The IUPAC name of methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate (CID 101026694) is methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate.
What is the SMILES notation for methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate?
The canonical SMILES for methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate is COC(=O)CC[C@@H]1CCC[C@H]1c1ccccc1.
What is the InChIKey of methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate?
The InChIKey is DBCYFXXJJFAATO-KBPBESRZSA-N. The full InChI is InChI=1S/C15H20O2/c1-17-15(16)11-10-13-8-5-9-14(13)12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3/t13-,14-/m0/s1.
What are the key properties of methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate?
methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate has a molecular weight of 232.32 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1S,2R)-2-phenylcyclopentyl]propanoate is sourced from PubChem (CID 101026694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).