C20H32O3 — CID 101026882
(1R,3R,5S,6S,10R,11R,14S)-14-ethenyl-6-(hydroxymethyl)-6,10,14-trimethyl-2-oxatetracyclo[9.4.0.01,3.05,10]pentadecan-11-ol (PubChem CID 101026882) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,3R,5S,6S,10R,11R,14S)-14-ethenyl-6-(hydroxymethyl)-6,10,14-trimethyl-2-oxatetracyclo[9.4.0.01,3.05,10]pentadecan-11-ol.
| Compound Name | (1R,3R,5S,6S,10R,11R,14S)-14-ethenyl-6-(hydroxymethyl)-6,10,14-trimethyl-2-oxatetracyclo[9.4.0.01,3.05,10]pentadecan-11-ol |
|---|---|
| PubChem CID | 101026882 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,3R,5S,6S,10R,11R,14S)-14-ethenyl-6-(hydroxymethyl)-6,10,14-trimethyl-2-oxatetracyclo[9.4.0.01,3.05,10]pentadecan-11-ol |
| SMILES | C=C[C@@]1(C)CC[C@@]2(O)[C@]3(C)CCC[C@](C)(CO)[C@@H]3C[C@H]3O[C@]32C1 |
| InChI | InChI=1S/C20H32O3/c1-5-16(2)9-10-20(22)18(4)8-6-7-17(3,13-21)14(18)11-15-19(20,12-16)23-15/h5,14-15,21-22H,1,6-13H2,2-4H3/t14-,15+,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | IMOGGJYMWTWRHW-BNLCHGIRSA-N |
| XLogP | 3.44 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|