About [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene
[(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene (PubChem CID 101026940) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene.
Molecular Properties
| Compound Name | [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene |
| PubChem CID | 101026940 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene |
| SMILES | C=C(C)[C@H](C)[C@@H](COc1ccccc1)OC |
| InChI | InChI=1S/C14H20O2/c1-11(2)12(3)14(15-4)10-16-13-8-6-5-7-9-13/h5-9,12,14H,1,10H2,2-4H3/t12-,14+/m0/s1 |
| InChIKey | CWKMAQDXZSQMAV-GXTWGEPZSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene?
The IUPAC name of [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene (CID 101026940) is [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene.
What is the SMILES notation for [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene?
The canonical SMILES for [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene is C=C(C)[C@H](C)[C@@H](COc1ccccc1)OC.
What is the InChIKey of [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene?
The InChIKey is CWKMAQDXZSQMAV-GXTWGEPZSA-N. The full InChI is InChI=1S/C14H20O2/c1-11(2)12(3)14(15-4)10-16-13-8-6-5-7-9-13/h5-9,12,14H,1,10H2,2-4H3/t12-,14+/m0/s1.
What are the key properties of [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene?
[(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene has a molecular weight of 220.31 g/mol, XLogP of 3.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-methoxy-3,4-dimethylpent-4-enoxy]benzene is sourced from PubChem (CID 101026940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).