About CID 101027078
CID 101027078 (PubChem CID 101027078) has the molecular formula C32H55O2
and a molecular weight of 471.79 g/mol.
Molecular Properties
| Compound Name | CID 101027078 |
| PubChem CID | 101027078 |
| Molecular Formula | C32H55O2 |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.42 |
| IUPAC Name | — |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(cc(C(C)C)c([O])c2C(C)C)O1 |
| InChI | InChI=1S/C32H55O2/c1-22(2)13-10-14-25(7)15-11-16-26(8)17-12-19-32(9)20-18-27-29(34-32)21-28(23(3)4)31(33)30(27)24(5)6/h21-26H,10-20H2,1-9H3/t25-,26-,32-/m1/s1 |
| InChIKey | HNZHURYPRPQIBI-ZAOJZYTHSA-N |
| XLogP | 10.60 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 101027078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101027078?
The IUPAC name of CID 101027078 (CID 101027078) is not available.
What is the SMILES notation for CID 101027078?
The canonical SMILES for CID 101027078 is CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(cc(C(C)C)c([O])c2C(C)C)O1.
What is the InChIKey of CID 101027078?
The InChIKey is HNZHURYPRPQIBI-ZAOJZYTHSA-N. The full InChI is InChI=1S/C32H55O2/c1-22(2)13-10-14-25(7)15-11-16-26(8)17-12-19-32(9)20-18-27-29(34-32)21-28(23(3)4)31(33)30(27)24(5)6/h21-26H,10-20H2,1-9H3/t25-,26-,32-/m1/s1.
What are the key properties of CID 101027078?
CID 101027078 has a molecular weight of 471.79 g/mol, XLogP of 10.60, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101027078 is sourced from PubChem (CID 101027078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).