C21H26N2 — CID 101027452
1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5,5'-diamine (PubChem CID 101027452) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5,5'-diamine.
| Compound Name | 1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5,5'-diamine |
|---|---|
| PubChem CID | 101027452 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5,5'-diamine |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(N)cc32)c2ccc(N)cc21 |
| InChI | InChI=1S/C21H26N2/c1-19(2)11-21(18-10-14(23)5-7-15(18)19)12-20(3,4)17-9-13(22)6-8-16(17)21/h5-10H,11-12,22-23H2,1-4H3 |
| InChIKey | RVAYLJZMIXUHNC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|