C23H19N3O2 — CID 101027506
2-(2,4-dimethoxyphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 101027506) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(2,4-dimethoxyphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 101027506 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C23H19N3O2/c1-27-18-13-14-19(20(15-18)28-2)23-25-21(16-9-5-3-6-10-16)24-22(26-23)17-11-7-4-8-12-17/h3-15H,1-2H3 |
| InChIKey | VAZWCMJXSRHYOJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |