C37H42O9SSi — CID 101027534
[(4R)-4-[[(2S,3R,6S)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-2-yl]oxy]-5-(benzenesulfonyl)pent-2-ynyl] acetate (PubChem CID 101027534) has the molecular formula C37H42O9SSi and a molecular weight of 690.89 g/mol. Its IUPAC name is [(4R)-4-[[(2S,3R,6S)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-2-yl]oxy]-5-(benzenesulfonyl)pent-2-ynyl] acetate.
| Compound Name | [(4R)-4-[[(2S,3R,6S)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-2-yl]oxy]-5-(benzenesulfonyl)pent-2-ynyl] acetate |
|---|---|
| PubChem CID | 101027534 |
| Molecular Formula | C37H42O9SSi |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.23 |
| IUPAC Name | [(4R)-4-[[(2S,3R,6S)-3-acetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-2-yl]oxy]-5-(benzenesulfonyl)pent-2-ynyl] acetate |
| SMILES | CC(=O)OCC#C[C@H](CS(=O)(=O)c1ccccc1)O[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H42O9SSi/c1-28(38)42-25-15-16-31(27-47(40,41)32-17-9-6-10-18-32)46-36-35(44-29(2)39)24-23-30(45-36)26-43-48(37(3,4)5,33-19-11-7-12-20-33)34-21-13-8-14-22-34/h6-14,17-24,30-31,35-36H,25-27H2,1-5H3/t30-,31+,35+,36-/m0/s1 |
| InChIKey | NZNZDKPQUPRSQH-HVMLIZDRSA-N |
| XLogP | 4.20 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|