C11H9F13O2S — CID 101027579
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-prop-2-enylsulfonyloctane (PubChem CID 101027579) has the molecular formula C11H9F13O2S and a molecular weight of 452.23 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-prop-2-enylsulfonyloctane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-prop-2-enylsulfonyloctane |
|---|---|
| PubChem CID | 101027579 |
| Molecular Formula | C11H9F13O2S |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-prop-2-enylsulfonyloctane |
| SMILES | C=CCS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F13O2S/c1-2-4-27(25,26)5-3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H,1,3-5H2 |
| InChIKey | PANRHIUWEHJRAZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|