About N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide
N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide (PubChem CID 101027823) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide |
| PubChem CID | 101027823 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide |
| SMILES | CC1=C(NS(C)(=O)=O)N=C(c2ccccc2)c2ccccc2N1C |
| InChI | InChI=1S/C18H19N3O2S/c1-13-18(20-24(3,22)23)19-17(14-9-5-4-6-10-14)15-11-7-8-12-16(15)21(13)2/h4-12,20H,1-3H3 |
| InChIKey | KZXWABPNWVLMDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide?
The IUPAC name of N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide (CID 101027823) is N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide.
What is the SMILES notation for N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide?
The canonical SMILES for N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide is CC1=C(NS(C)(=O)=O)N=C(c2ccccc2)c2ccccc2N1C.
What is the InChIKey of N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide?
The InChIKey is KZXWABPNWVLMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-13-18(20-24(3,22)23)19-17(14-9-5-4-6-10-14)15-11-7-8-12-16(15)21(13)2/h4-12,20H,1-3H3.
What are the key properties of N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide?
N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide has a molecular weight of 341.44 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dimethyl-5-phenyl-1,4-benzodiazepin-3-yl)methanesulfonamide is sourced from PubChem (CID 101027823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).