C9H11F9O — CID 101027898
5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-ol (PubChem CID 101027898) has the molecular formula C9H11F9O and a molecular weight of 306.17 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-ol.
| Compound Name | 5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-ol |
|---|---|
| PubChem CID | 101027898 |
| Molecular Formula | C9H11F9O |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-ol |
| SMILES | CC(C)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O/c1-5(2,19)3-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h19H,3-4H2,1-2H3 |
| InChIKey | RQVWCCCEFXMBKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|