C6ClF11O — CID 101028528
(2S,3R)-3-chloro-2,3-difluoro-2,4,4-tris(trifluoromethyl)oxetane (PubChem CID 101028528) has the molecular formula C6ClF11O and a molecular weight of 332.50 g/mol. Its IUPAC name is (2S,3R)-3-chloro-2,3-difluoro-2,4,4-tris(trifluoromethyl)oxetane.
| Compound Name | (2S,3R)-3-chloro-2,3-difluoro-2,4,4-tris(trifluoromethyl)oxetane |
|---|---|
| PubChem CID | 101028528 |
| Molecular Formula | C6ClF11O |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | (2S,3R)-3-chloro-2,3-difluoro-2,4,4-tris(trifluoromethyl)oxetane |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[C@](F)(C(F)(F)F)[C@]1(F)Cl |
| InChI | InChI=1S/C6ClF11O/c7-2(8)1(4(10,11)12,5(13,14)15)19-3(2,9)6(16,17)18/t2-,3-/m0/s1 |
| InChIKey | KVWMUWMGLONMIV-HRFVKAFMSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|