C22H42O3Si — CID 101029306
tert-butyl-[2-[(2R,3S,6R)-9-butyl-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-2-yl]ethoxy]-dimethylsilane (PubChem CID 101029306) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3S,6R)-9-butyl-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(2R,3S,6R)-9-butyl-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101029306 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | tert-butyl-[2-[(2R,3S,6R)-9-butyl-3-methyl-1,7-dioxaspiro[5.5]undec-8-en-2-yl]ethoxy]-dimethylsilane |
| SMILES | CCCCC1=CO[C@@]2(CC1)CC[C@H](C)[C@@H](CCO[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C22H42O3Si/c1-8-9-10-19-12-15-22(23-17-19)14-11-18(2)20(25-22)13-16-24-26(6,7)21(3,4)5/h17-18,20H,8-16H2,1-7H3/t18-,20+,22-/m0/s1 |
| InChIKey | OKGPVSXLTSXXEJ-DWLFOUALSA-N |
| XLogP | 6.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|