C28H31NO2 — CID 101029468
tert-butyl (3R,4R)-4-(benzylideneamino)-4-(4-methylphenyl)-3-phenylbutanoate (PubChem CID 101029468) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-(benzylideneamino)-4-(4-methylphenyl)-3-phenylbutanoate.
| Compound Name | tert-butyl (3R,4R)-4-(benzylideneamino)-4-(4-methylphenyl)-3-phenylbutanoate |
|---|---|
| PubChem CID | 101029468 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | tert-butyl (3R,4R)-4-(benzylideneamino)-4-(4-methylphenyl)-3-phenylbutanoate |
| SMILES | Cc1ccc([C@H](/N=C/c2ccccc2)[C@H](CC(=O)OC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO2/c1-21-15-17-24(18-16-21)27(29-20-22-11-7-5-8-12-22)25(23-13-9-6-10-14-23)19-26(30)31-28(2,3)4/h5-18,20,25,27H,19H2,1-4H3/b29-20+/t25-,27+/m1/s1 |
| InChIKey | FVYUMUJYXMJAHA-OUZNAQPQSA-N |
| XLogP | 6.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|