C24H25NO6 — CID 101029523
(4R,5S)-3-[(1R,4R,5R,6R)-4-methoxy-2-oxo-4-propyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 101029523) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (4R,5S)-3-[(1R,4R,5R,6R)-4-methoxy-2-oxo-4-propyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1R,4R,5R,6R)-4-methoxy-2-oxo-4-propyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101029523 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (4R,5S)-3-[(1R,4R,5R,6R)-4-methoxy-2-oxo-4-propyl-3,7-dioxabicyclo[4.1.0]heptan-5-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@]1(OC)OC(=O)[C@@H]2O[C@@H]2[C@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO6/c1-3-14-24(28-2)21(19-20(29-19)22(26)31-24)25-17(15-10-6-4-7-11-15)18(30-23(25)27)16-12-8-5-9-13-16/h4-13,17-21H,3,14H2,1-2H3/t17-,18+,19+,20-,21-,24-/m1/s1 |
| InChIKey | YOYKFQNXFSSCFZ-BOZSFFBESA-N |
| XLogP | 3.76 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|