C18H22OS — CID 101029561
9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide (PubChem CID 101029561) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide.
| Compound Name | 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide |
|---|---|
| PubChem CID | 101029561 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2-oxide |
| SMILES | O=S1C=C2C=C3CCCCC3C(C3=CCCCC3)C2=C1 |
| InChI | InChI=1S/C18H22OS/c19-20-11-15-10-14-8-4-5-9-16(14)18(17(15)12-20)13-6-2-1-3-7-13/h6,10-12,16,18H,1-5,7-9H2 |
| InChIKey | PWIMNZOKMKLLBD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|